C25H24ClF3N4O2S — CID 58391457
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[2-hydroxypentyl(methyl)amino]-1,3-thiazol-4-one (PubChem CID 58391457) has the molecular formula C25H24ClF3N4O2S and a molecular weight of 537.01 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[2-hydroxypentyl(methyl)amino]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[2-hydroxypentyl(methyl)amino]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58391457 |
| Molecular Formula | C25H24ClF3N4O2S |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[2-hydroxypentyl(methyl)amino]-1,3-thiazol-4-one |
| SMILES | CCCC(O)CN(C)C1=NC(=O)/C(=C/c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C25H24ClF3N4O2S/c1-3-4-19(34)14-32(2)24-31-23(35)22(36-24)10-15-5-8-21-17(9-15)12-30-33(21)13-16-6-7-18(26)11-20(16)25(27,28)29/h5-12,19,34H,3-4,13-14H2,1-2H3/b22-10- |
| InChIKey | WXEFNHNHFDNNCT-YVNNLAQVSA-N |
| XLogP | 5.82 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|