C25H24ClF3N4O3S — CID 58391472
(5Z)-2-[bis(2-methoxyethyl)amino]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 58391472) has the molecular formula C25H24ClF3N4O3S and a molecular weight of 553.01 g/mol. Its IUPAC name is (5Z)-2-[bis(2-methoxyethyl)amino]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[bis(2-methoxyethyl)amino]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58391472 |
| Molecular Formula | C25H24ClF3N4O3S |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | (5Z)-2-[bis(2-methoxyethyl)amino]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | COCCN(CCOC)C1=NC(=O)/C(=C/c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C25H24ClF3N4O3S/c1-35-9-7-32(8-10-36-2)24-31-23(34)22(37-24)12-16-3-6-21-18(11-16)14-30-33(21)15-17-4-5-19(26)13-20(17)25(27,28)29/h3-6,11-14H,7-10,15H2,1-2H3/b22-12- |
| InChIKey | LOHJAPMRKDUQCJ-UUYOSTAYSA-N |
| XLogP | 5.32 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|