C26H19ClF3N5OS — CID 67346555
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(pyridin-3-ylmethyl)amino]-1,3-thiazol-4-one (PubChem CID 67346555) has the molecular formula C26H19ClF3N5OS and a molecular weight of 541.99 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(pyridin-3-ylmethyl)amino]-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(pyridin-3-ylmethyl)amino]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67346555 |
| Molecular Formula | C26H19ClF3N5OS |
| Molecular Weight | 541.99 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(pyridin-3-ylmethyl)amino]-1,3-thiazol-4-one |
| SMILES | CN(Cc1cccnc1)C1=NC(=O)C(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C26H19ClF3N5OS/c1-34(14-17-3-2-8-31-12-17)25-33-24(36)23(37-25)10-16-4-7-22-19(9-16)13-32-35(22)15-18-5-6-20(27)11-21(18)26(28,29)30/h2-13H,14-15H2,1H3 |
| InChIKey | SSUITPAJRGAZKI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.99 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|