C23H18ClF3N4OS — CID 58391514
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(prop-2-enyl)amino]-1,3-thiazol-4-one (PubChem CID 58391514) has the molecular formula C23H18ClF3N4OS and a molecular weight of 490.94 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(prop-2-enyl)amino]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(prop-2-enyl)amino]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58391514 |
| Molecular Formula | C23H18ClF3N4OS |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methyl(prop-2-enyl)amino]-1,3-thiazol-4-one |
| SMILES | C=CCN(C)C1=NC(=O)/C(=C/c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C23H18ClF3N4OS/c1-3-8-30(2)22-29-21(32)20(33-22)10-14-4-7-19-16(9-14)12-28-31(19)13-15-5-6-17(24)11-18(15)23(25,26)27/h3-7,9-12H,1,8,13H2,2H3/b20-10- |
| InChIKey | SDHPHDPFUFZDOR-JMIUGGIZSA-N |
| XLogP | 5.84 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|