C19H11ClF3N3OS2 — CID 86656521
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 86656521) has the molecular formula C19H11ClF3N3OS2 and a molecular weight of 453.90 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 86656521 |
| Molecular Formula | C19H11ClF3N3OS2 |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11ClF3N3OS2/c20-13-3-2-11(14(7-13)19(21,22)23)9-26-15-4-1-10(5-12(15)8-24-26)6-16-17(27)25-18(28)29-16/h1-8H,9H2,(H,25,27,28) |
| InChIKey | MGXHHJNLMVEFNV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|