C23H19ClF3N5O2S — CID 137098355
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]imino-1,3-thiazolidin-4-one (PubChem CID 137098355) has the molecular formula C23H19ClF3N5O2S and a molecular weight of 521.95 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137098355 |
| Molecular Formula | C23H19ClF3N5O2S |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\[C@@H]2CNC[C@H]2O)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19ClF3N5O2S/c24-15-3-2-13(16(7-15)23(25,26)27)11-32-18-4-1-12(5-14(18)8-29-32)6-20-21(34)31-22(35-20)30-17-9-28-10-19(17)33/h1-8,17,19,28,33H,9-11H2,(H,30,31,34)/t17-,19-/m1/s1 |
| InChIKey | QRXJEENGCMIEEY-IEBWSBKVSA-N |
| XLogP | 3.65 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|