C18H40N2O3Si2 — CID 123525590
N'-[4-[2-(2-dimethylsilyloxan-2-yl)oxan-2-yl]silyloxybutyl]ethane-1,2-diamine (PubChem CID 123525590) has the molecular formula C18H40N2O3Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is N'-[4-[2-(2-dimethylsilyloxan-2-yl)oxan-2-yl]silyloxybutyl]ethane-1,2-diamine.
| Compound Name | N'-[4-[2-(2-dimethylsilyloxan-2-yl)oxan-2-yl]silyloxybutyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123525590 |
| Molecular Formula | C18H40N2O3Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N'-[4-[2-(2-dimethylsilyloxan-2-yl)oxan-2-yl]silyloxybutyl]ethane-1,2-diamine |
| SMILES | C[SiH](C)C1(C2([SiH2]OCCCCNCCN)CCCCO2)CCCCO1 |
| InChI | InChI=1S/C18H40N2O3Si2/c1-25(2)18(10-4-7-15-22-18)17(9-3-6-14-21-17)24-23-16-8-5-12-20-13-11-19/h20,25H,3-16,19,24H2,1-2H3 |
| InChIKey | BJLUIMSHIRSBFQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|