C24H49NO3Si3 — CID 173351569
3-[[2-[[2-[2-[ethenyl(methyl)silyl]oxan-2-yl]oxan-2-yl]-dimethylsilyl]oxan-2-yl]-methylsilyl]propan-1-amine (PubChem CID 173351569) has the molecular formula C24H49NO3Si3 and a molecular weight of 483.92 g/mol. Its IUPAC name is 3-[[2-[[2-[2-[ethenyl(methyl)silyl]oxan-2-yl]oxan-2-yl]-dimethylsilyl]oxan-2-yl]-methylsilyl]propan-1-amine.
| Compound Name | 3-[[2-[[2-[2-[ethenyl(methyl)silyl]oxan-2-yl]oxan-2-yl]-dimethylsilyl]oxan-2-yl]-methylsilyl]propan-1-amine |
|---|---|
| PubChem CID | 173351569 |
| Molecular Formula | C24H49NO3Si3 |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 3-[[2-[[2-[2-[ethenyl(methyl)silyl]oxan-2-yl]oxan-2-yl]-dimethylsilyl]oxan-2-yl]-methylsilyl]propan-1-amine |
| SMILES | C=C[SiH](C)C1(C2([Si](C)(C)C3([SiH](C)CCCN)CCCCO3)CCCCO2)CCCCO1 |
| InChI | InChI=1S/C24H49NO3Si3/c1-6-29(2)22(14-7-10-18-26-22)23(15-8-11-19-27-23)31(4,5)24(16-9-12-20-28-24)30(3)21-13-17-25/h6,29-30H,1,7-21,25H2,2-5H3 |
| InChIKey | FNSKSYLAENIGCQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|