C11H30N2O6Si2 — CID 151278639
N'-[4-[dimethoxy(trimethoxysilyl)silyl]oxybutyl]ethane-1,2-diamine (PubChem CID 151278639) has the molecular formula C11H30N2O6Si2 and a molecular weight of 342.54 g/mol. Its IUPAC name is N'-[4-[dimethoxy(trimethoxysilyl)silyl]oxybutyl]ethane-1,2-diamine.
| Compound Name | N'-[4-[dimethoxy(trimethoxysilyl)silyl]oxybutyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 151278639 |
| Molecular Formula | C11H30N2O6Si2 |
| Molecular Weight | 342.54 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N'-[4-[dimethoxy(trimethoxysilyl)silyl]oxybutyl]ethane-1,2-diamine |
| SMILES | CO[Si](OC)(OC)[Si](OC)(OC)OCCCCNCCN |
| InChI | InChI=1S/C11H30N2O6Si2/c1-14-20(15-2,16-3)21(17-4,18-5)19-11-7-6-9-13-10-8-12/h13H,6-12H2,1-5H3 |
| InChIKey | NXXBVAQIJQHSLW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.54 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|