C26H21F4N5O3 — CID 123527059
4-[4-[[[3-(2-fluoro-3-pyridinyl)-5-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 123527059) has the molecular formula C26H21F4N5O3 and a molecular weight of 527.48 g/mol. Its IUPAC name is 4-[4-[[[3-(2-fluoro-3-pyridinyl)-5-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[[3-(2-fluoro-3-pyridinyl)-5-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123527059 |
| Molecular Formula | C26H21F4N5O3 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 4-[4-[[[3-(2-fluoro-3-pyridinyl)-5-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(O)Nc3cc(-c4cccnc4F)cc(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C26H21F4N5O3/c1-31-24(36)22-14-20(8-10-32-22)38-19-6-4-17(5-7-19)34-25(37)35-18-12-15(11-16(13-18)26(28,29)30)21-3-2-9-33-23(21)27/h2-14,25,34-35,37H,1H3,(H,31,36) |
| InChIKey | SHTXTZCNENQADK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|