C17H40ClN4O+ — CID 123529732
[(2,8-diamino-2-methylnonanoyl)amino]methyl-(3-methylpentan-3-yl)azanium;hydrochloride (PubChem CID 123529732) has the molecular formula C17H40ClN4O+ and a molecular weight of 351.99 g/mol. Its IUPAC name is [(2,8-diamino-2-methylnonanoyl)amino]methyl-(3-methylpentan-3-yl)azanium;hydrochloride.
| Compound Name | [(2,8-diamino-2-methylnonanoyl)amino]methyl-(3-methylpentan-3-yl)azanium;hydrochloride |
|---|---|
| PubChem CID | 123529732 |
| Molecular Formula | C17H40ClN4O+ |
| Molecular Weight | 351.99 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | [(2,8-diamino-2-methylnonanoyl)amino]methyl-(3-methylpentan-3-yl)azanium;hydrochloride |
| SMILES | CCC(C)(CC)[NH2+]CNC(=O)C(C)(N)CCCCCC(C)N.Cl |
| InChI | InChI=1S/C17H38N4O.ClH/c1-6-16(4,7-2)21-13-20-15(22)17(5,19)12-10-8-9-11-14(3)18;/h14,21H,6-13,18-19H2,1-5H3,(H,20,22);1H/p+1 |
| InChIKey | IEUHJOUXOCXEED-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.99 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|