C17H38N4O — CID 58264355
2,8-diamino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide (PubChem CID 58264355) has the molecular formula C17H38N4O and a molecular weight of 314.52 g/mol. Its IUPAC name is 2,8-diamino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide.
| Compound Name | 2,8-diamino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide |
|---|---|
| PubChem CID | 58264355 |
| Molecular Formula | C17H38N4O |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | 2,8-diamino-2-methyl-N-[(3-methylpentan-3-ylamino)methyl]nonanamide |
| SMILES | CCC(C)(CC)NCNC(=O)C(C)(N)CCCCCC(C)N |
| InChI | InChI=1S/C17H38N4O/c1-6-16(4,7-2)21-13-20-15(22)17(5,19)12-10-8-9-11-14(3)18/h14,21H,6-13,18-19H2,1-5H3,(H,20,22) |
| InChIKey | VATJPDXJDIZPLZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|