C31H64 — CID 123530373
6,8,10,15-tetramethyl-12-(4-methylhexyl)icosane (PubChem CID 123530373) has the molecular formula C31H64 and a molecular weight of 436.85 g/mol. Its IUPAC name is 6,8,10,15-tetramethyl-12-(4-methylhexyl)icosane.
| Compound Name | 6,8,10,15-tetramethyl-12-(4-methylhexyl)icosane |
|---|---|
| PubChem CID | 123530373 |
| Molecular Formula | C31H64 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.50 |
| IUPAC Name | 6,8,10,15-tetramethyl-12-(4-methylhexyl)icosane |
| SMILES | CCCCCC(C)CCC(CCCC(C)CC)CC(C)CC(C)CC(C)CCCCC |
| InChI | InChI=1S/C31H64/c1-9-12-14-17-27(5)21-22-31(20-16-19-26(4)11-3)25-30(8)24-29(7)23-28(6)18-15-13-10-2/h26-31H,9-25H2,1-8H3 |
| InChIKey | BZAQQAXAYDSYPO-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|