About octadecan-9-ylsilane
octadecan-9-ylsilane (PubChem CID 123535784) has the molecular formula C18H40Si
and a molecular weight of 284.60 g/mol. Its IUPAC name is octadecan-9-ylsilane.
Molecular Properties
| Compound Name | octadecan-9-ylsilane |
| PubChem CID | 123535784 |
| Molecular Formula | C18H40Si |
| Molecular Weight | 284.60 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | octadecan-9-ylsilane |
| SMILES | CCCCCCCCCC([SiH3])CCCCCCCC |
| InChI | InChI=1S/C18H40Si/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h18H,3-17H2,1-2,19H3 |
| InChIKey | GAMFLFWUVHRKIL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octadecan-9-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecan-9-ylsilane?
The IUPAC name of octadecan-9-ylsilane (CID 123535784) is octadecan-9-ylsilane.
What is the SMILES notation for octadecan-9-ylsilane?
The canonical SMILES for octadecan-9-ylsilane is CCCCCCCCCC([SiH3])CCCCCCCC.
What is the InChIKey of octadecan-9-ylsilane?
The InChIKey is GAMFLFWUVHRKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40Si/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h18H,3-17H2,1-2,19H3.
What are the key properties of octadecan-9-ylsilane?
octadecan-9-ylsilane has a molecular weight of 284.60 g/mol, XLogP of 6.03, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for octadecan-9-ylsilane is sourced from PubChem (CID 123535784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).