About nonan-3-ylsilane
nonan-3-ylsilane (PubChem CID 174876500) has the molecular formula C9H22Si
and a molecular weight of 158.36 g/mol. Its IUPAC name is nonan-3-ylsilane.
Molecular Properties
| Compound Name | nonan-3-ylsilane |
| PubChem CID | 174876500 |
| Molecular Formula | C9H22Si |
| Molecular Weight | 158.36 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | nonan-3-ylsilane |
| SMILES | CCCCCCC([SiH3])CC |
| InChI | InChI=1S/C9H22Si/c1-3-5-6-7-8-9(10)4-2/h9H,3-8H2,1-2,10H3 |
| InChIKey | DZVHHOGLPYFUCM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze nonan-3-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-3-ylsilane?
The IUPAC name of nonan-3-ylsilane (CID 174876500) is nonan-3-ylsilane.
What is the SMILES notation for nonan-3-ylsilane?
The canonical SMILES for nonan-3-ylsilane is CCCCCCC([SiH3])CC.
What is the InChIKey of nonan-3-ylsilane?
The InChIKey is DZVHHOGLPYFUCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22Si/c1-3-5-6-7-8-9(10)4-2/h9H,3-8H2,1-2,10H3.
What are the key properties of nonan-3-ylsilane?
nonan-3-ylsilane has a molecular weight of 158.36 g/mol, XLogP of 2.52, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-3-ylsilane is sourced from PubChem (CID 174876500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).