C18H32O8Si — CID 123535819
1-[(3S,4R,5R,6S)-4,5-diacetyl-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-3,4,5-trihydroxyoxan-3-yl]ethanone (PubChem CID 123535819) has the molecular formula C18H32O8Si and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-[(3S,4R,5R,6S)-4,5-diacetyl-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-3,4,5-trihydroxyoxan-3-yl]ethanone.
| Compound Name | 1-[(3S,4R,5R,6S)-4,5-diacetyl-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-3,4,5-trihydroxyoxan-3-yl]ethanone |
|---|---|
| PubChem CID | 123535819 |
| Molecular Formula | C18H32O8Si |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[(3S,4R,5R,6S)-4,5-diacetyl-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-3,4,5-trihydroxyoxan-3-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)[C@](O)(C(C)=O)CO[C@H](C(O)[Si](C)(C)C(C)(C)C)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C18H32O8Si/c1-10(19)16(23)9-26-13(14(22)27(7,8)15(4,5)6)17(24,11(2)20)18(16,25)12(3)21/h13-14,22-25H,9H2,1-8H3/t13-,14?,16-,17-,18-/m1/s1 |
| InChIKey | GQXRFHNNUOPSPO-NQMSWDQOSA-N |
| XLogP | -0.25 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|