C14H20O9 — CID 57161507
2-hydroxy-1-[(2S,3S,4R,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one (PubChem CID 57161507) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-hydroxy-1-[(2S,3S,4R,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one.
| Compound Name | 2-hydroxy-1-[(2S,3S,4R,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 57161507 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-hydroxy-1-[(2S,3S,4R,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one |
| SMILES | CC(=O)[C@@]1(O)[C@](O)(C(C)=O)CO[C@H](C(=O)C(C)O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C14H20O9/c1-6(15)10(19)11-13(21,8(3)17)14(22,9(4)18)12(20,5-23-11)7(2)16/h6,11,15,20-22H,5H2,1-4H3/t6?,11-,12-,13+,14-/m1/s1 |
| InChIKey | IGRRHMHIHPOPIK-ODRRBVSFSA-N |
| XLogP | -2.70 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |