C19H21Cl2NO3 — CID 123536716
3-(2,6-dichloro-4-prop-1-ynylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]decan-2-one (PubChem CID 123536716) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-prop-1-ynylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]decan-2-one.
| Compound Name | 3-(2,6-dichloro-4-prop-1-ynylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 123536716 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-(2,6-dichloro-4-prop-1-ynylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]decan-2-one |
| SMILES | CC#Cc1cc(Cl)c(C2C(=O)NC3(CCC(OC)CC3)C2O)c(Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-3-4-11-9-13(20)15(14(21)10-11)16-17(23)19(22-18(16)24)7-5-12(25-2)6-8-19/h9-10,12,16-17,23H,5-8H2,1-2H3,(H,22,24) |
| InChIKey | MDAXWQNIDWFWMV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|