C6H15NO2Si — CID 123537400
2-(1,2-dimethoxyethenylsilyl)ethanamine (PubChem CID 123537400) has the molecular formula C6H15NO2Si and a molecular weight of 161.28 g/mol. Its IUPAC name is 2-(1,2-dimethoxyethenylsilyl)ethanamine.
| Compound Name | 2-(1,2-dimethoxyethenylsilyl)ethanamine |
|---|---|
| PubChem CID | 123537400 |
| Molecular Formula | C6H15NO2Si |
| Molecular Weight | 161.28 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 2-(1,2-dimethoxyethenylsilyl)ethanamine |
| SMILES | COC=C(OC)[SiH2]CCN |
| InChI | InChI=1S/C6H15NO2Si/c1-8-5-6(9-2)10-4-3-7/h5H,3-4,7,10H2,1-2H3 |
| InChIKey | QKDRMUWSRPUVPR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|