C6H13N3O — CID 164593356
(2Z,4E)-4-methoxypenta-2,4-diene-1,2,5-triamine (PubChem CID 164593356) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is (2Z,4E)-4-methoxypenta-2,4-diene-1,2,5-triamine.
| Compound Name | (2Z,4E)-4-methoxypenta-2,4-diene-1,2,5-triamine |
|---|---|
| PubChem CID | 164593356 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (2Z,4E)-4-methoxypenta-2,4-diene-1,2,5-triamine |
| SMILES | COC(/C=C(\N)CN)=C/N |
| InChI | InChI=1S/C6H13N3O/c1-10-6(4-8)2-5(9)3-7/h2,4H,3,7-9H2,1H3/b5-2-,6-4+ |
| InChIKey | ZSZQHJGABQSZQL-HKEQSYRLSA-N |
| XLogP | -0.77 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|