C7H11N3 — CID 163722687
(E,2E)-4,5-diamino-2-ethylidenepent-3-enenitrile (PubChem CID 163722687) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (E,2E)-4,5-diamino-2-ethylidenepent-3-enenitrile.
| Compound Name | (E,2E)-4,5-diamino-2-ethylidenepent-3-enenitrile |
|---|---|
| PubChem CID | 163722687 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (E,2E)-4,5-diamino-2-ethylidenepent-3-enenitrile |
| SMILES | C/C=C(C#N)\C=C(\N)CN |
| InChI | InChI=1S/C7H11N3/c1-2-6(4-8)3-7(10)5-9/h2-3H,5,9-10H2,1H3/b6-2+,7-3+ |
| InChIKey | KSXMSFGKRNKMNC-YPCIICBESA-N |
| XLogP | 0.26 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|