C8H12N2 — CID 146318029
(E,2E)-2-ethylidene-4-(methylamino)pent-3-enenitrile (PubChem CID 146318029) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (E,2E)-2-ethylidene-4-(methylamino)pent-3-enenitrile.
| Compound Name | (E,2E)-2-ethylidene-4-(methylamino)pent-3-enenitrile |
|---|---|
| PubChem CID | 146318029 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (E,2E)-2-ethylidene-4-(methylamino)pent-3-enenitrile |
| SMILES | C/C=C(C#N)\C=C(/C)NC |
| InChI | InChI=1S/C8H12N2/c1-4-8(6-9)5-7(2)10-3/h4-5,10H,1-3H3/b7-5+,8-4+ |
| InChIKey | FXHMSMABJADGJZ-JBVHCYJISA-N |
| XLogP | 1.58 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|