C12H20N2 — CID 167149958
(Z,2E)-4-ethyl-2-ethylidene-5-(methylamino)hept-3-enenitrile (PubChem CID 167149958) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (Z,2E)-4-ethyl-2-ethylidene-5-(methylamino)hept-3-enenitrile.
| Compound Name | (Z,2E)-4-ethyl-2-ethylidene-5-(methylamino)hept-3-enenitrile |
|---|---|
| PubChem CID | 167149958 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (Z,2E)-4-ethyl-2-ethylidene-5-(methylamino)hept-3-enenitrile |
| SMILES | C/C=C(C#N)\C=C(\CC)C(CC)NC |
| InChI | InChI=1S/C12H20N2/c1-5-10(9-13)8-11(6-2)12(7-3)14-4/h5,8,12,14H,6-7H2,1-4H3/b10-5+,11-8- |
| InChIKey | RXKYLJNHPVDINI-REZFLJOXSA-N |
| XLogP | 2.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|