C8H14N2 — CID 146360770
(2Z,4Z)-4-ethenylhexa-2,4-diene-1,2-diamine (PubChem CID 146360770) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z,4Z)-4-ethenylhexa-2,4-diene-1,2-diamine.
| Compound Name | (2Z,4Z)-4-ethenylhexa-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 146360770 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2Z,4Z)-4-ethenylhexa-2,4-diene-1,2-diamine |
| SMILES | C=CC(=C/C)/C=C(\N)CN |
| InChI | InChI=1S/C8H14N2/c1-3-7(4-2)5-8(10)6-9/h3-5H,1,6,9-10H2,2H3/b7-4-,8-5- |
| InChIKey | KHRWWWKRAAZZDV-IUNAMMOKSA-N |
| XLogP | 0.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|