C15H22N2O2 — CID 153497948
(1Z,3Z,6E,8Z)-4-ethenyl-2,8-dimethoxyundeca-1,3,6,8,10-pentaene-1,9-diamine (PubChem CID 153497948) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1Z,3Z,6E,8Z)-4-ethenyl-2,8-dimethoxyundeca-1,3,6,8,10-pentaene-1,9-diamine.
| Compound Name | (1Z,3Z,6E,8Z)-4-ethenyl-2,8-dimethoxyundeca-1,3,6,8,10-pentaene-1,9-diamine |
|---|---|
| PubChem CID | 153497948 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1Z,3Z,6E,8Z)-4-ethenyl-2,8-dimethoxyundeca-1,3,6,8,10-pentaene-1,9-diamine |
| SMILES | C=C/C(=C\C(=C\N)OC)C/C=C/C(OC)=C(/N)C=C |
| InChI | InChI=1S/C15H22N2O2/c1-5-12(10-13(11-16)18-3)8-7-9-15(19-4)14(17)6-2/h5-7,9-11H,1-2,8,16-17H2,3-4H3/b9-7+,12-10+,13-11-,15-14- |
| InChIKey | YHECMTKVBATXKF-AKSOVUSXSA-N |
| XLogP | 2.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|