C15H24O2 — CID 142520586
(2Z,4Z,7Z)-5-ethenyl-3-methoxydodeca-2,4,7-trien-2-ol (PubChem CID 142520586) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2Z,4Z,7Z)-5-ethenyl-3-methoxydodeca-2,4,7-trien-2-ol.
| Compound Name | (2Z,4Z,7Z)-5-ethenyl-3-methoxydodeca-2,4,7-trien-2-ol |
|---|---|
| PubChem CID | 142520586 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2Z,4Z,7Z)-5-ethenyl-3-methoxydodeca-2,4,7-trien-2-ol |
| SMILES | C=C/C(=C\C(OC)=C(/C)O)C/C=C\CCCC |
| InChI | InChI=1S/C15H24O2/c1-5-7-8-9-10-11-14(6-2)12-15(17-4)13(3)16/h6,9-10,12,16H,2,5,7-8,11H2,1,3-4H3/b10-9-,14-12+,15-13- |
| InChIKey | GFGILYOAENTADU-NDXGLMGLSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|