C7H13BrN2O — CID 144666196
(1E,3E)-1-bromo-3-propan-2-yloxybuta-1,3-diene-1,4-diamine (PubChem CID 144666196) has the molecular formula C7H13BrN2O and a molecular weight of 221.10 g/mol. Its IUPAC name is (1E,3E)-1-bromo-3-propan-2-yloxybuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-bromo-3-propan-2-yloxybuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 144666196 |
| Molecular Formula | C7H13BrN2O |
| Molecular Weight | 221.10 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | (1E,3E)-1-bromo-3-propan-2-yloxybuta-1,3-diene-1,4-diamine |
| SMILES | CC(C)OC(/C=C(\N)Br)=C/N |
| InChI | InChI=1S/C7H13BrN2O/c1-5(2)11-6(4-9)3-7(8)10/h3-5H,9-10H2,1-2H3/b6-4+,7-3- |
| InChIKey | NCVHOYZVXHUCKG-KUSYPTLRSA-N |
| XLogP | 1.41 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.10 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|