C6H12BrN3 — CID 144665837
(1E,3E)-4-bromo-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine (PubChem CID 144665837) has the molecular formula C6H12BrN3 and a molecular weight of 206.09 g/mol. Its IUPAC name is (1E,3E)-4-bromo-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine.
| Compound Name | (1E,3E)-4-bromo-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 144665837 |
| Molecular Formula | C6H12BrN3 |
| Molecular Weight | 206.09 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | (1E,3E)-4-bromo-2-N,2-N-dimethylbuta-1,3-diene-1,2,4-triamine |
| SMILES | CN(C)C(/C=C(\N)Br)=C/N |
| InChI | InChI=1S/C6H12BrN3/c1-10(2)5(4-8)3-6(7)9/h3-4H,8-9H2,1-2H3/b5-4+,6-3- |
| InChIKey | WQVHRIUCYNCCPE-FQYFJTKBSA-N |
| XLogP | 0.54 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.09 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|