C8H18N2O3 — CID 166849383
2-amino-1-[[(Z)-1,3-dimethoxybut-1-en-2-yl]amino]ethanol (PubChem CID 166849383) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-amino-1-[[(Z)-1,3-dimethoxybut-1-en-2-yl]amino]ethanol.
| Compound Name | 2-amino-1-[[(Z)-1,3-dimethoxybut-1-en-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 166849383 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-amino-1-[[(Z)-1,3-dimethoxybut-1-en-2-yl]amino]ethanol |
| SMILES | CO/C=C(\NC(O)CN)C(C)OC |
| InChI | InChI=1S/C8H18N2O3/c1-6(13-3)7(5-12-2)10-8(11)4-9/h5-6,8,10-11H,4,9H2,1-3H3/b7-5- |
| InChIKey | IMSMDMBJDZICFM-ALCCZGGFSA-N |
| XLogP | -0.62 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|