C15H26N2 — CID 123538088
N,2-dimethyl-N-[1-(3-propanimidoylcyclopenta-2,4-dien-1-yl)ethyl]propan-1-amine (PubChem CID 123538088) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N,2-dimethyl-N-[1-(3-propanimidoylcyclopenta-2,4-dien-1-yl)ethyl]propan-1-amine.
| Compound Name | N,2-dimethyl-N-[1-(3-propanimidoylcyclopenta-2,4-dien-1-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 123538088 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N,2-dimethyl-N-[1-(3-propanimidoylcyclopenta-2,4-dien-1-yl)ethyl]propan-1-amine |
| SMILES | [H]/N=C(\CC)C1=CC(C(C)N(C)CC(C)C)C=C1 |
| InChI | InChI=1S/C15H26N2/c1-6-15(16)14-8-7-13(9-14)12(4)17(5)10-11(2)3/h7-9,11-13,16H,6,10H2,1-5H3/b16-15+ |
| InChIKey | NERLDWGXNIOOSG-FOCLMDBBSA-N |
| XLogP | 3.50 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|