C11H18N2 — CID 144627063
3-cyclohexa-1,5-dien-1-yl-3-imino-N,N-dimethylpropan-1-amine (PubChem CID 144627063) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-3-imino-N,N-dimethylpropan-1-amine.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-3-imino-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 144627063 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-3-imino-N,N-dimethylpropan-1-amine |
| SMILES | [H]/N=C(\CCN(C)C)C1=CCCC=C1 |
| InChI | InChI=1S/C11H18N2/c1-13(2)9-8-11(12)10-6-4-3-5-7-10/h4,6-7,12H,3,5,8-9H2,1-2H3/b12-11+ |
| InChIKey | JSCZHWGFVSZJBO-VAWYXSNFSA-N |
| XLogP | 2.23 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|