C12H22N2 — CID 123750276
3-ethenyl-6-imino-N,N-dimethyloct-3-en-2-amine (PubChem CID 123750276) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 3-ethenyl-6-imino-N,N-dimethyloct-3-en-2-amine.
| Compound Name | 3-ethenyl-6-imino-N,N-dimethyloct-3-en-2-amine |
|---|---|
| PubChem CID | 123750276 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 3-ethenyl-6-imino-N,N-dimethyloct-3-en-2-amine |
| SMILES | [H]/N=C(\CC)CC=C(C=C)C(C)N(C)C |
| InChI | InChI=1S/C12H22N2/c1-6-11(10(3)14(4)5)8-9-12(13)7-2/h6,8,10,13H,1,7,9H2,2-5H3/b11-8?,13-12+ |
| InChIKey | MVHLWKNMHKDEHR-ZHSPKSDKSA-N |
| XLogP | 2.87 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|