C14H24N2 — CID 123494969
N-[[(1Z)-8-iminocycloocta-1,3-dien-1-yl]methyl]-N-methylbutan-1-amine (PubChem CID 123494969) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[[(1Z)-8-iminocycloocta-1,3-dien-1-yl]methyl]-N-methylbutan-1-amine.
| Compound Name | N-[[(1Z)-8-iminocycloocta-1,3-dien-1-yl]methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 123494969 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[[(1Z)-8-iminocycloocta-1,3-dien-1-yl]methyl]-N-methylbutan-1-amine |
| SMILES | [H]/N=C1CCCC=C/C=C\1CN(C)CCCC |
| InChI | InChI=1S/C14H24N2/c1-3-4-11-16(2)12-13-9-7-5-6-8-10-14(13)15/h5,7,9,15H,3-4,6,8,10-12H2,1-2H3/b7-5?,13-9-,15-14+ |
| InChIKey | OIIWTQDCNQYUBB-KHNRRIHZSA-N |
| XLogP | 3.40 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|