C19H40N2 — CID 172567559
(2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine;heptane (PubChem CID 172567559) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is (2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine;heptane.
| Compound Name | (2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine;heptane |
|---|---|
| PubChem CID | 172567559 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | (2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine;heptane |
| SMILES | CCCCCCC.[H]/N=C(CCCC)/C(=C/C)CN(C)CC |
| InChI | InChI=1S/C12H24N2.C7H16/c1-5-8-9-12(13)11(6-2)10-14(4)7-3;1-3-5-7-6-4-2/h6,13H,5,7-10H2,1-4H3;3-7H2,1-2H3/b11-6+,13-12+; |
| InChIKey | OANSDBNJRWQTLI-MRWAXVCRSA-N |
| XLogP | 6.07 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|