C18H35N3S — CID 172566725
heptane;(NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine (PubChem CID 172566725) has the molecular formula C18H35N3S and a molecular weight of 325.57 g/mol. Its IUPAC name is heptane;(NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine.
| Compound Name | heptane;(NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine |
|---|---|
| PubChem CID | 172566725 |
| Molecular Formula | C18H35N3S |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | heptane;(NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine |
| SMILES | CCCCCCC.[H]/N=C(C1=CCCN(C)C1)\C(CCC)=N/S |
| InChI | InChI=1S/C11H19N3S.C7H16/c1-3-5-10(13-15)11(12)9-6-4-7-14(2)8-9;1-3-5-7-6-4-2/h6,12,15H,3-5,7-8H2,1-2H3;3-7H2,1-2H3/b12-11-,13-10-; |
| InChIKey | NRVYPMAZAMYSER-AXROJKFOSA-N |
| XLogP | 5.33 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|