C17H32N3S+ — CID 172566862
(NZ)-N-[1-(1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)-2-iminononylidene]thiohydroxylamine (PubChem CID 172566862) has the molecular formula C17H32N3S+ and a molecular weight of 310.53 g/mol. Its IUPAC name is (NZ)-N-[1-(1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)-2-iminononylidene]thiohydroxylamine.
| Compound Name | (NZ)-N-[1-(1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)-2-iminononylidene]thiohydroxylamine |
|---|---|
| PubChem CID | 172566862 |
| Molecular Formula | C17H32N3S+ |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (NZ)-N-[1-(1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)-2-iminononylidene]thiohydroxylamine |
| SMILES | [H]/N=C(CCCCCCC)/C(=N\S)C1=CCC[N+](C)(CC)C1 |
| InChI | InChI=1S/C17H31N3S/c1-4-6-7-8-9-12-16(18)17(19-21)15-11-10-13-20(3,5-2)14-15/h11,18H,4-10,12-14H2,1-3H3/p+1/b18-16+,19-17- |
| InChIKey | BVCIUPAPMCEQHU-KZTQHSAISA-O |
| XLogP | 4.45 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|