C20H38N3+ — CID 172566586
1-(1-heptan-2-yl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)heptane-1,2-diimine (PubChem CID 172566586) has the molecular formula C20H38N3+ and a molecular weight of 320.55 g/mol. Its IUPAC name is 1-(1-heptan-2-yl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)heptane-1,2-diimine.
| Compound Name | 1-(1-heptan-2-yl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)heptane-1,2-diimine |
|---|---|
| PubChem CID | 172566586 |
| Molecular Formula | C20H38N3+ |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | 1-(1-heptan-2-yl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)heptane-1,2-diimine |
| SMILES | [H]/N=C(C1=CCC[N+](C)(C(C)CCCCC)C1)\C(CCCCC)=N\[H] |
| InChI | InChI=1S/C20H38N3/c1-5-7-9-12-17(3)23(4)15-11-13-18(16-23)20(22)19(21)14-10-8-6-2/h13,17,21-22H,5-12,14-16H2,1-4H3/q+1/b21-19+,22-20- |
| InChIKey | BHGUMTAMPFRVKO-FHGBILNFSA-N |
| XLogP | 5.35 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|