C30H42N4 — CID 91013575
1-[10-(4-imino-2-methyl-6,8a-dihydroquinolin-1-yl)decyl]-2-methyl-6,8a-dihydroquinolin-4-imine (PubChem CID 91013575) has the molecular formula C30H42N4 and a molecular weight of 458.69 g/mol. Its IUPAC name is 1-[10-(4-imino-2-methyl-6,8a-dihydroquinolin-1-yl)decyl]-2-methyl-6,8a-dihydroquinolin-4-imine.
| Compound Name | 1-[10-(4-imino-2-methyl-6,8a-dihydroquinolin-1-yl)decyl]-2-methyl-6,8a-dihydroquinolin-4-imine |
|---|---|
| PubChem CID | 91013575 |
| Molecular Formula | C30H42N4 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 1-[10-(4-imino-2-methyl-6,8a-dihydroquinolin-1-yl)decyl]-2-methyl-6,8a-dihydroquinolin-4-imine |
| SMILES | [H]/N=C1\C=C(C)N(CCCCCCCCCCN2C(C)=C/C(=N\[H])C3=CCC=CC32)C2C=CCC=C12 |
| InChI | InChI=1S/C30H42N4/c1-23-21-27(31)25-15-9-11-17-29(25)33(23)19-13-7-5-3-4-6-8-14-20-34-24(2)22-28(32)26-16-10-12-18-30(26)34/h11-12,15-18,21-22,29-32H,3-10,13-14,19-20H2,1-2H3/b31-27+,32-28+ |
| InChIKey | QPLZABUCOVUFAL-WWQQVGJXSA-N |
| XLogP | 7.10 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|