C24H33N3 — CID 138400998
5-ethyl-3-imino-6-nonylphenanthridin-8-amine (PubChem CID 138400998) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is 5-ethyl-3-imino-6-nonylphenanthridin-8-amine.
| Compound Name | 5-ethyl-3-imino-6-nonylphenanthridin-8-amine |
|---|---|
| PubChem CID | 138400998 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | 5-ethyl-3-imino-6-nonylphenanthridin-8-amine |
| SMILES | [H]/N=c1\ccc2c3ccc(N)cc3c(CCCCCCCCC)n(CC)c-2c1 |
| InChI | InChI=1S/C24H33N3/c1-3-5-6-7-8-9-10-11-23-22-16-18(25)12-14-20(22)21-15-13-19(26)17-24(21)27(23)4-2/h12-17,26H,3-11,25H2,1-2H3/b26-19+ |
| InChIKey | VWZQDLAKWFIQFF-LGUFXXKBSA-N |
| XLogP | 6.12 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|