C22H29N3 — CID 138400996
5-ethyl-6-heptyl-3-iminophenanthridin-8-amine (PubChem CID 138400996) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is 5-ethyl-6-heptyl-3-iminophenanthridin-8-amine.
| Compound Name | 5-ethyl-6-heptyl-3-iminophenanthridin-8-amine |
|---|---|
| PubChem CID | 138400996 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 5-ethyl-6-heptyl-3-iminophenanthridin-8-amine |
| SMILES | [H]/N=c1\ccc2c3ccc(N)cc3c(CCCCCCC)n(CC)c-2c1 |
| InChI | InChI=1S/C22H29N3/c1-3-5-6-7-8-9-21-20-14-16(23)10-12-18(20)19-13-11-17(24)15-22(19)25(21)4-2/h10-15,24H,3-9,23H2,1-2H3/b24-17+ |
| InChIKey | BILGVZZRCIOOHY-JJIBRWJFSA-N |
| XLogP | 5.34 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|