C15H27N3 — CID 177225040
1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)nonane-1,2-diimine (PubChem CID 177225040) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)nonane-1,2-diimine.
| Compound Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)nonane-1,2-diimine |
|---|---|
| PubChem CID | 177225040 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)nonane-1,2-diimine |
| SMILES | [H]/N=C(C1=CCCN(C)C1)\C(CCCCCCC)=N\[H] |
| InChI | InChI=1S/C15H27N3/c1-3-4-5-6-7-10-14(16)15(17)13-9-8-11-18(2)12-13/h9,16-17H,3-8,10-12H2,1-2H3/b16-14+,17-15- |
| InChIKey | XWZRLRDXACHCOJ-GGTPAPDOSA-N |
| XLogP | 3.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|