C12H19N2+ — CID 163419716
2,2,5-trimethyl-1,3,4,8-tetrahydroisoquinolin-2-ium-7-imine (PubChem CID 163419716) has the molecular formula C12H19N2+ and a molecular weight of 191.30 g/mol. Its IUPAC name is 2,2,5-trimethyl-1,3,4,8-tetrahydroisoquinolin-2-ium-7-imine.
| Compound Name | 2,2,5-trimethyl-1,3,4,8-tetrahydroisoquinolin-2-ium-7-imine |
|---|---|
| PubChem CID | 163419716 |
| Molecular Formula | C12H19N2+ |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | 2,2,5-trimethyl-1,3,4,8-tetrahydroisoquinolin-2-ium-7-imine |
| SMILES | [H]/N=C1\C=C(C)C2=C(C1)C[N+](C)(C)CC2 |
| InChI | InChI=1S/C12H19N2/c1-9-6-11(13)7-10-8-14(2,3)5-4-12(9)10/h6,13H,4-5,7-8H2,1-3H3/q+1/b13-11+ |
| InChIKey | FNZCSNLDTMSDHI-ACCUITESSA-N |
| XLogP | 2.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|