C11H19N3S — CID 172566726
(NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine (PubChem CID 172566726) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is (NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine.
| Compound Name | (NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine |
|---|---|
| PubChem CID | 172566726 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (NZ)-N-[1-imino-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)pentan-2-ylidene]thiohydroxylamine |
| SMILES | [H]/N=C(C1=CCCN(C)C1)\C(CCC)=N/S |
| InChI | InChI=1S/C11H19N3S/c1-3-5-10(13-15)11(12)9-6-4-7-14(2)8-9/h6,12,15H,3-5,7-8H2,1-2H3/b12-11-,13-10- |
| InChIKey | VYDAQQHGLMWTJN-RBPRBBOISA-N |
| XLogP | 2.35 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|