C11H20N2 — CID 176943094
1-(6-ethyl-1,2,3,6-tetrahydropyridin-5-yl)butan-1-imine (PubChem CID 176943094) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-(6-ethyl-1,2,3,6-tetrahydropyridin-5-yl)butan-1-imine.
| Compound Name | 1-(6-ethyl-1,2,3,6-tetrahydropyridin-5-yl)butan-1-imine |
|---|---|
| PubChem CID | 176943094 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-(6-ethyl-1,2,3,6-tetrahydropyridin-5-yl)butan-1-imine |
| SMILES | [H]/N=C(\CCC)C1=CCCNC1CC |
| InChI | InChI=1S/C11H20N2/c1-3-6-10(12)9-7-5-8-13-11(9)4-2/h7,11-13H,3-6,8H2,1-2H3/b12-10+ |
| InChIKey | NBNWXTSMWVBOQU-ZRDIBKRKSA-N |
| XLogP | 2.50 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|