C15H24N2 — CID 123720024
4-[(4-methylpiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine (PubChem CID 123720024) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-[(4-methylpiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine.
| Compound Name | 4-[(4-methylpiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123720024 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 4-[(4-methylpiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(CN2CCC(C)CC2)=CCCC1 |
| InChI | InChI=1S/C15H24N2/c1-13-8-10-17(11-9-13)12-14-4-2-3-5-15(16)7-6-14/h4,6-7,13,16H,2-3,5,8-12H2,1H3/b7-6?,14-4?,16-15+ |
| InChIKey | VTWUNKIHWAFIPE-VDSQZBJMSA-N |
| XLogP | 3.40 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|