C14H20F2N2 — CID 123881999
(2Z)-2-[(4,4-difluoropiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine (PubChem CID 123881999) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is (2Z)-2-[(4,4-difluoropiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-[(4,4-difluoropiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123881999 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (2Z)-2-[(4,4-difluoropiperidin-1-yl)methyl]cycloocta-2,4-dien-1-imine |
| SMILES | [H]/N=C1CCCC=C/C=C\1CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H20F2N2/c15-14(16)7-9-18(10-8-14)11-12-5-3-1-2-4-6-13(12)17/h1,3,5,17H,2,4,6-11H2/b3-1?,12-5-,17-13+ |
| InChIKey | HVONUORXRIFNBX-PULZHQFKSA-N |
| XLogP | 3.40 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|