C16H30N2O3 — CID 123539850
tert-butyl 3-[acetyl(propyl)amino]-4-methylpiperidine-1-carboxylate (PubChem CID 123539850) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl 3-[acetyl(propyl)amino]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[acetyl(propyl)amino]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123539850 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl 3-[acetyl(propyl)amino]-4-methylpiperidine-1-carboxylate |
| SMILES | CCCN(C(C)=O)C1CN(C(=O)OC(C)(C)C)CCC1C |
| InChI | InChI=1S/C16H30N2O3/c1-7-9-18(13(3)19)14-11-17(10-8-12(14)2)15(20)21-16(4,5)6/h12,14H,7-11H2,1-6H3 |
| InChIKey | MMQVVMUBWIGJAC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |