C7H13NOS2 — CID 123541245
1,4-dithia-7-azaspiro[4.4]nonan-8-ylmethanol (PubChem CID 123541245) has the molecular formula C7H13NOS2 and a molecular weight of 191.32 g/mol. Its IUPAC name is 1,4-dithia-7-azaspiro[4.4]nonan-8-ylmethanol.
| Compound Name | 1,4-dithia-7-azaspiro[4.4]nonan-8-ylmethanol |
|---|---|
| PubChem CID | 123541245 |
| Molecular Formula | C7H13NOS2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 1,4-dithia-7-azaspiro[4.4]nonan-8-ylmethanol |
| SMILES | OCC1CC2(CN1)SCCS2 |
| InChI | InChI=1S/C7H13NOS2/c9-4-6-3-7(5-8-6)10-1-2-11-7/h6,8-9H,1-5H2 |
| InChIKey | LJPVMYGOYROKEG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |