C22H38N4O4 — CID 123542318
methyl N-[2-[2-[[[2-[(Z)-hept-1-enyl]-1-(methylcarbamoyl)cyclobutyl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 123542318) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl N-[2-[2-[[[2-[(Z)-hept-1-enyl]-1-(methylcarbamoyl)cyclobutyl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[2-[[[2-[(Z)-hept-1-enyl]-1-(methylcarbamoyl)cyclobutyl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 123542318 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | methyl N-[2-[2-[[[2-[(Z)-hept-1-enyl]-1-(methylcarbamoyl)cyclobutyl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CCCCC/C=C\C1CCC1(NCC1CCCN1C(=O)CNC(=O)OC)C(=O)NC |
| InChI | InChI=1S/C22H38N4O4/c1-4-5-6-7-8-10-17-12-13-22(17,20(28)23-2)25-15-18-11-9-14-26(18)19(27)16-24-21(29)30-3/h8,10,17-18,25H,4-7,9,11-16H2,1-3H3,(H,23,28)(H,24,29)/b10-8- |
| InChIKey | NVMCMFGCQQWAED-NTMALXAHSA-N |
| XLogP | 1.95 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|