C29H35N5O3 — CID 123542360
N-[4-(2-aminocyclopropyl)phenyl]-3-[[hydroxy(phenylmethoxy)methyl]amino]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 123542360) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[4-(2-aminocyclopropyl)phenyl]-3-[[hydroxy(phenylmethoxy)methyl]amino]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[4-(2-aminocyclopropyl)phenyl]-3-[[hydroxy(phenylmethoxy)methyl]amino]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 123542360 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | N-[4-(2-aminocyclopropyl)phenyl]-3-[[hydroxy(phenylmethoxy)methyl]amino]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3ccc(C4CC4N)cc3)cc2NC(O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H35N5O3/c1-33-13-15-34(16-14-33)27-12-9-22(17-26(27)32-29(36)37-19-20-5-3-2-4-6-20)28(35)31-23-10-7-21(8-11-23)24-18-25(24)30/h2-12,17,24-25,29,32,36H,13-16,18-19,30H2,1H3,(H,31,35) |
| InChIKey | RSLIYFGIPKOWOL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|